About 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one
4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one (PubChem CID 19845453) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one |
| PubChem CID | 19845453 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one |
| SMILES | C=C1OC(=O)OC1(C)CCCCCCCC |
| InChI | InChI=1S/C13H22O3/c1-4-5-6-7-8-9-10-13(3)11(2)15-12(14)16-13/h2,4-10H2,1,3H3 |
| InChIKey | HIYZLJUPGPASBH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one?
The IUPAC name of 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one (CID 19845453) is 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one.
What is the SMILES notation for 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one?
The canonical SMILES for 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one is C=C1OC(=O)OC1(C)CCCCCCCC.
What is the InChIKey of 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one?
The InChIKey is HIYZLJUPGPASBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-4-5-6-7-8-9-10-13(3)11(2)15-12(14)16-13/h2,4-10H2,1,3H3.
What are the key properties of 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one?
4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one has a molecular weight of 226.32 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylidene-4-octyl-1,3-dioxolan-2-one is sourced from PubChem (CID 19845453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).