C18H20N2O — CID 19846148
2-amino-N-(2-phenyl-1,3-dihydroinden-2-yl)propanamide (PubChem CID 19846148) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-N-(2-phenyl-1,3-dihydroinden-2-yl)propanamide.
| Compound Name | 2-amino-N-(2-phenyl-1,3-dihydroinden-2-yl)propanamide |
|---|---|
| PubChem CID | 19846148 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-amino-N-(2-phenyl-1,3-dihydroinden-2-yl)propanamide |
| SMILES | CC(N)C(=O)NC1(c2ccccc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H20N2O/c1-13(19)17(21)20-18(16-9-3-2-4-10-16)11-14-7-5-6-8-15(14)12-18/h2-10,13H,11-12,19H2,1H3,(H,20,21) |
| InChIKey | KMLUEUQVTIBXGP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |