C27H36N2O4 — CID 19846235
tert-butyl N-[1-(cyclohexylamino)-1-oxo-3-(3-phenylmethoxyphenyl)propan-2-yl]carbamate (PubChem CID 19846235) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is tert-butyl N-[1-(cyclohexylamino)-1-oxo-3-(3-phenylmethoxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(cyclohexylamino)-1-oxo-3-(3-phenylmethoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 19846235 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | tert-butyl N-[1-(cyclohexylamino)-1-oxo-3-(3-phenylmethoxyphenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccc(OCc2ccccc2)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H36N2O4/c1-27(2,3)33-26(31)29-24(25(30)28-22-14-8-5-9-15-22)18-21-13-10-16-23(17-21)32-19-20-11-6-4-7-12-20/h4,6-7,10-13,16-17,22,24H,5,8-9,14-15,18-19H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | CSUAJWNCJNUNHV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |