About oxetane-3-carboxylate
oxetane-3-carboxylate (PubChem CID 19847185) has the molecular formula C4H5O3-
and a molecular weight of 101.08 g/mol. Its IUPAC name is oxetane-3-carboxylate.
Molecular Properties
| Compound Name | oxetane-3-carboxylate |
| PubChem CID | 19847185 |
| Molecular Formula | C4H5O3- |
| Molecular Weight | 101.08 g/mol |
| Exact Mass | 101.02 |
| IUPAC Name | oxetane-3-carboxylate |
| SMILES | O=C([O-])C1COC1 |
| InChI | InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6)/p-1 |
| InChIKey | UWOTZNQZPLAURK-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.08 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxetane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetane-3-carboxylate?
The IUPAC name of oxetane-3-carboxylate (CID 19847185) is oxetane-3-carboxylate.
What is the SMILES notation for oxetane-3-carboxylate?
The canonical SMILES for oxetane-3-carboxylate is O=C([O-])C1COC1.
What is the InChIKey of oxetane-3-carboxylate?
The InChIKey is UWOTZNQZPLAURK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6)/p-1.
What are the key properties of oxetane-3-carboxylate?
oxetane-3-carboxylate has a molecular weight of 101.08 g/mol, XLogP of -1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetane-3-carboxylate is sourced from PubChem (CID 19847185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).