About 2,2-diethyl-1,4-dihydroxypiperazine
2,2-diethyl-1,4-dihydroxypiperazine (PubChem CID 19847195) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2,2-diethyl-1,4-dihydroxypiperazine.
Molecular Properties
| Compound Name | 2,2-diethyl-1,4-dihydroxypiperazine |
| PubChem CID | 19847195 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2,2-diethyl-1,4-dihydroxypiperazine |
| SMILES | CCC1(CC)CN(O)CCN1O |
| InChI | InChI=1S/C8H18N2O2/c1-3-8(4-2)7-9(11)5-6-10(8)12/h11-12H,3-7H2,1-2H3 |
| InChIKey | AQCAEZVOIPGREG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-diethyl-1,4-dihydroxypiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1,4-dihydroxypiperazine?
The IUPAC name of 2,2-diethyl-1,4-dihydroxypiperazine (CID 19847195) is 2,2-diethyl-1,4-dihydroxypiperazine.
What is the SMILES notation for 2,2-diethyl-1,4-dihydroxypiperazine?
The canonical SMILES for 2,2-diethyl-1,4-dihydroxypiperazine is CCC1(CC)CN(O)CCN1O.
What is the InChIKey of 2,2-diethyl-1,4-dihydroxypiperazine?
The InChIKey is AQCAEZVOIPGREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-3-8(4-2)7-9(11)5-6-10(8)12/h11-12H,3-7H2,1-2H3.
What are the key properties of 2,2-diethyl-1,4-dihydroxypiperazine?
2,2-diethyl-1,4-dihydroxypiperazine has a molecular weight of 174.24 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1,4-dihydroxypiperazine is sourced from PubChem (CID 19847195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).