About 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine
2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine (PubChem CID 19848034) has the molecular formula C17H34N2O3
and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine |
| PubChem CID | 19848034 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine |
| SMILES | CC(CC1(C)CNCC(C)O1)OCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C17H34N2O3/c1-13(8-17(5)12-18-9-14(2)22-17)20-7-6-19-10-15(3)21-16(4)11-19/h13-16,18H,6-12H2,1-5H3 |
| InChIKey | BPQASJYBPVUVIL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine?
The IUPAC name of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine (CID 19848034) is 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine.
What is the SMILES notation for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine?
The canonical SMILES for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine is CC(CC1(C)CNCC(C)O1)OCCN1CC(C)OC(C)C1.
What is the InChIKey of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine?
The InChIKey is BPQASJYBPVUVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O3/c1-13(8-17(5)12-18-9-14(2)22-17)20-7-6-19-10-15(3)21-16(4)11-19/h13-16,18H,6-12H2,1-5H3.
What are the key properties of 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine?
2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine has a molecular weight of 314.47 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]propyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 19848034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).