About 1,1-dimethylsilinane-3,4-diamine
1,1-dimethylsilinane-3,4-diamine (PubChem CID 19848451) has the molecular formula C7H18N2Si
and a molecular weight of 158.32 g/mol. Its IUPAC name is 1,1-dimethylsilinane-3,4-diamine.
Molecular Properties
| Compound Name | 1,1-dimethylsilinane-3,4-diamine |
| PubChem CID | 19848451 |
| Molecular Formula | C7H18N2Si |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1,1-dimethylsilinane-3,4-diamine |
| SMILES | C[Si]1(C)CCC(N)C(N)C1 |
| InChI | InChI=1S/C7H18N2Si/c1-10(2)4-3-6(8)7(9)5-10/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | ZKFFIPOVKHQHNV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylsilinane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylsilinane-3,4-diamine?
The IUPAC name of 1,1-dimethylsilinane-3,4-diamine (CID 19848451) is 1,1-dimethylsilinane-3,4-diamine.
What is the SMILES notation for 1,1-dimethylsilinane-3,4-diamine?
The canonical SMILES for 1,1-dimethylsilinane-3,4-diamine is C[Si]1(C)CCC(N)C(N)C1.
What is the InChIKey of 1,1-dimethylsilinane-3,4-diamine?
The InChIKey is ZKFFIPOVKHQHNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2Si/c1-10(2)4-3-6(8)7(9)5-10/h6-7H,3-5,8-9H2,1-2H3.
What are the key properties of 1,1-dimethylsilinane-3,4-diamine?
1,1-dimethylsilinane-3,4-diamine has a molecular weight of 158.32 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylsilinane-3,4-diamine is sourced from PubChem (CID 19848451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).