C13H22N2 — CID 19848556
2,4-diethyl-5,5-bis(prop-2-enyl)-1,4-dihydroimidazole (PubChem CID 19848556) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,4-diethyl-5,5-bis(prop-2-enyl)-1,4-dihydroimidazole.
| Compound Name | 2,4-diethyl-5,5-bis(prop-2-enyl)-1,4-dihydroimidazole |
|---|---|
| PubChem CID | 19848556 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,4-diethyl-5,5-bis(prop-2-enyl)-1,4-dihydroimidazole |
| SMILES | C=CCC1(CC=C)NC(CC)=NC1CC |
| InChI | InChI=1S/C13H22N2/c1-5-9-13(10-6-2)11(7-3)14-12(8-4)15-13/h5-6,11H,1-2,7-10H2,3-4H3,(H,14,15) |
| InChIKey | XWWCULVDFCPSJT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|