C18H26N2 — CID 19848863
3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-5-methyl-1H-indole (PubChem CID 19848863) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-5-methyl-1H-indole.
| Compound Name | 3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-5-methyl-1H-indole |
|---|---|
| PubChem CID | 19848863 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-5-methyl-1H-indole |
| SMILES | Cc1ccc2[nH]cc(CCN3C(C)CCCC3C)c2c1 |
| InChI | InChI=1S/C18H26N2/c1-13-7-8-18-17(11-13)16(12-19-18)9-10-20-14(2)5-4-6-15(20)3/h7-8,11-12,14-15,19H,4-6,9-10H2,1-3H3 |
| InChIKey | QYBRZKDNIVPQRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |