C21H23BrN2S — CID 19848943
7-bromo-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole (PubChem CID 19848943) has the molecular formula C21H23BrN2S and a molecular weight of 415.40 g/mol. Its IUPAC name is 7-bromo-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole.
| Compound Name | 7-bromo-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole |
|---|---|
| PubChem CID | 19848943 |
| Molecular Formula | C21H23BrN2S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 7-bromo-3-[4-(4-thiophen-2-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole |
| SMILES | Brc1cccc2c(CCCCC3CC(c4cccs4)=CCN3)c[nH]c12 |
| InChI | InChI=1S/C21H23BrN2S/c22-19-8-3-7-18-16(14-24-21(18)19)5-1-2-6-17-13-15(10-11-23-17)20-9-4-12-25-20/h3-4,7-10,12,14,17,23-24H,1-2,5-6,11,13H2 |
| InChIKey | YGFYVNLHSICDAK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|