C9H3BrCl3F6N2O- — CID 19849803
2,2,2-trifluoro-N-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]acetohydrazide bromide (PubChem CID 19849803) has the molecular formula C9H3BrCl3F6N2O- and a molecular weight of 455.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]acetohydrazide bromide.
| Compound Name | 2,2,2-trifluoro-N-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]acetohydrazide bromide |
|---|---|
| PubChem CID | 19849803 |
| Molecular Formula | C9H3BrCl3F6N2O- |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 452.84 |
| IUPAC Name | 2,2,2-trifluoro-N-[2,3,6-trichloro-4-(trifluoromethyl)phenyl]acetohydrazide bromide |
| SMILES | NN(C(=O)C(F)(F)F)c1c(Cl)cc(C(F)(F)F)c(Cl)c1Cl.[Br-] |
| InChI | InChI=1S/C9H3Cl3F6N2O.BrH/c10-3-1-2(8(13,14)15)4(11)5(12)6(3)20(19)7(21)9(16,17)18;/h1H,19H2;1H/p-1 |
| InChIKey | DOKQZSMJGYLAFH-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|