About 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline
5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline (PubChem CID 19850016) has the molecular formula C52H34N4O2
and a molecular weight of 746.87 g/mol. Its IUPAC name is 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline.
Molecular Properties
| Compound Name | 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline |
| PubChem CID | 19850016 |
| Molecular Formula | C52H34N4O2 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.27 |
| IUPAC Name | 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline |
| SMILES | c1ccc(Oc2ccc(-c3cc4nc(-c5ccccc5)c(-c5ccccc5)nc4c(-c4ccc(Oc5ccccc5)cc4)c3-c3ccc4nccnc4c3)cc2)cc1 |
| InChI | InChI=1S/C52H34N4O2/c1-5-13-37(14-6-1)50-51(38-15-7-2-8-16-38)56-52-47(55-50)34-44(35-21-26-42(27-22-35)57-40-17-9-3-10-18-40)48(39-25-30-45-46(33-39)54-32-31-53-45)49(52)36-23-28-43(29-24-36)58-41-19-11-4-12-20-41/h1-34H |
| InChIKey | TVYUIFVAYVAGEH-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline?
The IUPAC name of 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline (CID 19850016) is 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline.
What is the SMILES notation for 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline?
The canonical SMILES for 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline is c1ccc(Oc2ccc(-c3cc4nc(-c5ccccc5)c(-c5ccccc5)nc4c(-c4ccc(Oc5ccccc5)cc4)c3-c3ccc4nccnc4c3)cc2)cc1.
What is the InChIKey of 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline?
The InChIKey is TVYUIFVAYVAGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H34N4O2/c1-5-13-37(14-6-1)50-51(38-15-7-2-8-16-38)56-52-47(55-50)34-44(35-21-26-42(27-22-35)57-40-17-9-3-10-18-40)48(39-25-30-45-46(33-39)54-32-31-53-45)49(52)36-23-28-43(29-24-36)58-41-19-11-4-12-20-41/h1-34H.
What are the key properties of 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline?
5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline has a molecular weight of 746.87 g/mol, XLogP of 13.49, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-bis(4-phenoxyphenyl)-2,3-diphenyl-6-quinoxalin-6-ylquinoxaline is sourced from PubChem (CID 19850016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).