C21H25ClN4O6 — CID 19850115
[(2-chlorophenyl)-[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl] acetate (PubChem CID 19850115) has the molecular formula C21H25ClN4O6 and a molecular weight of 464.91 g/mol. Its IUPAC name is [(2-chlorophenyl)-[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl] acetate.
| Compound Name | [(2-chlorophenyl)-[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl] acetate |
|---|---|
| PubChem CID | 19850115 |
| Molecular Formula | C21H25ClN4O6 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2-chlorophenyl)-[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl] acetate |
| SMILES | CC(=O)OC(c1ccccc1Cl)N1C(=O)CN(C(C)C(C)N2CC(=O)NC(=O)C2)CC1=O |
| InChI | InChI=1S/C21H25ClN4O6/c1-12(24-8-17(28)23-18(29)9-24)13(2)25-10-19(30)26(20(31)11-25)21(32-14(3)27)15-6-4-5-7-16(15)22/h4-7,12-13,21H,8-11H2,1-3H3,(H,23,28,29) |
| InChIKey | PQIKFHFTPPCIMD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|