About 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane
5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane (PubChem CID 19850335) has the molecular formula C10H19FO2
and a molecular weight of 190.26 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane.
Molecular Properties
| Compound Name | 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane |
| PubChem CID | 19850335 |
| Molecular Formula | C10H19FO2 |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane |
| SMILES | CC(F)C1OC(C)C(C)OCC1C |
| InChI | InChI=1S/C10H19FO2/c1-6-5-12-8(3)9(4)13-10(6)7(2)11/h6-10H,5H2,1-4H3 |
| InChIKey | JSOXTWRXBTUGLD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane?
The IUPAC name of 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane (CID 19850335) is 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane.
What is the SMILES notation for 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane?
The canonical SMILES for 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane is CC(F)C1OC(C)C(C)OCC1C.
What is the InChIKey of 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane?
The InChIKey is JSOXTWRXBTUGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FO2/c1-6-5-12-8(3)9(4)13-10(6)7(2)11/h6-10H,5H2,1-4H3.
What are the key properties of 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane?
5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane has a molecular weight of 190.26 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-fluoroethyl)-2,3,6-trimethyl-1,4-dioxepane is sourced from PubChem (CID 19850335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).