About 7a-methoxy-3aH-1,3-benzodioxole
7a-methoxy-3aH-1,3-benzodioxole (PubChem CID 19850516) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 7a-methoxy-3aH-1,3-benzodioxole.
Molecular Properties
| Compound Name | 7a-methoxy-3aH-1,3-benzodioxole |
| PubChem CID | 19850516 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 7a-methoxy-3aH-1,3-benzodioxole |
| SMILES | COC12C=CC=CC1OCO2 |
| InChI | InChI=1S/C8H10O3/c1-9-8-5-3-2-4-7(8)10-6-11-8/h2-5,7H,6H2,1H3 |
| InChIKey | YLEYNVHWDAZYTC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7a-methoxy-3aH-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methoxy-3aH-1,3-benzodioxole?
The IUPAC name of 7a-methoxy-3aH-1,3-benzodioxole (CID 19850516) is 7a-methoxy-3aH-1,3-benzodioxole.
What is the SMILES notation for 7a-methoxy-3aH-1,3-benzodioxole?
The canonical SMILES for 7a-methoxy-3aH-1,3-benzodioxole is COC12C=CC=CC1OCO2.
What is the InChIKey of 7a-methoxy-3aH-1,3-benzodioxole?
The InChIKey is YLEYNVHWDAZYTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-9-8-5-3-2-4-7(8)10-6-11-8/h2-5,7H,6H2,1H3.
What are the key properties of 7a-methoxy-3aH-1,3-benzodioxole?
7a-methoxy-3aH-1,3-benzodioxole has a molecular weight of 154.16 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methoxy-3aH-1,3-benzodioxole is sourced from PubChem (CID 19850516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).