About 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one
3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one (PubChem CID 19850883) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one |
| PubChem CID | 19850883 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CCCCOC1C(=O)c2cccc(O)c2OC1(C)C |
| InChI | InChI=1S/C15H20O4/c1-4-5-9-18-14-12(17)10-7-6-8-11(16)13(10)19-15(14,2)3/h6-8,14,16H,4-5,9H2,1-3H3 |
| InChIKey | NFAUVMNOWXNZFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one?
The IUPAC name of 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one (CID 19850883) is 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one.
What is the SMILES notation for 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one?
The canonical SMILES for 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one is CCCCOC1C(=O)c2cccc(O)c2OC1(C)C.
What is the InChIKey of 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one?
The InChIKey is NFAUVMNOWXNZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-4-5-9-18-14-12(17)10-7-6-8-11(16)13(10)19-15(14,2)3/h6-8,14,16H,4-5,9H2,1-3H3.
What are the key properties of 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one?
3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one has a molecular weight of 264.32 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-8-hydroxy-2,2-dimethyl-3H-chromen-4-one is sourced from PubChem (CID 19850883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).