About 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate
3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate (PubChem CID 19851187) has the molecular formula C14H19N2O2-
and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate.
Molecular Properties
| Compound Name | 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate |
| PubChem CID | 19851187 |
| Molecular Formula | C14H19N2O2- |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate |
| SMILES | Cc1cc(C2CCC=C(CCC(=O)[O-])C2)n(C)n1 |
| InChI | InChI=1S/C14H20N2O2/c1-10-8-13(16(2)15-10)12-5-3-4-11(9-12)6-7-14(17)18/h4,8,12H,3,5-7,9H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | SOLOAKXCJJNJPZ-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate?
The IUPAC name of 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate (CID 19851187) is 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate.
What is the SMILES notation for 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate?
The canonical SMILES for 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate is Cc1cc(C2CCC=C(CCC(=O)[O-])C2)n(C)n1.
What is the InChIKey of 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate?
The InChIKey is SOLOAKXCJJNJPZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H20N2O2/c1-10-8-13(16(2)15-10)12-5-3-4-11(9-12)6-7-14(17)18/h4,8,12H,3,5-7,9H2,1-2H3,(H,17,18)/p-1.
What are the key properties of 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate?
3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate has a molecular weight of 247.32 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,5-dimethylpyrazol-3-yl)cyclohexen-1-yl]propanoate is sourced from PubChem (CID 19851187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).