C20H13ClFN3O — CID 19851520
3-[2-(2-chlorophenyl)ethynyl]-8-fluoro-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one (PubChem CID 19851520) has the molecular formula C20H13ClFN3O and a molecular weight of 365.80 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethynyl]-8-fluoro-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one.
| Compound Name | 3-[2-(2-chlorophenyl)ethynyl]-8-fluoro-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 19851520 |
| Molecular Formula | C20H13ClFN3O |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethynyl]-8-fluoro-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one |
| SMILES | CN1Cc2c(C#Cc3ccccc3Cl)ncn2-c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C20H13ClFN3O/c1-24-11-19-17(8-6-13-4-2-3-5-16(13)21)23-12-25(19)18-9-7-14(22)10-15(18)20(24)26/h2-5,7,9-10,12H,11H2,1H3 |
| InChIKey | YCMRKXJBIYJTAZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|