C25H24BrClF3N3O4S — CID 19852505
methyl 2-(4-bromo-N-[5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazole-2-carbonyl]anilino)-2-oxoacetate (PubChem CID 19852505) has the molecular formula C25H24BrClF3N3O4S and a molecular weight of 634.90 g/mol. Its IUPAC name is methyl 2-(4-bromo-N-[5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazole-2-carbonyl]anilino)-2-oxoacetate.
| Compound Name | methyl 2-(4-bromo-N-[5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazole-2-carbonyl]anilino)-2-oxoacetate |
|---|---|
| PubChem CID | 19852505 |
| Molecular Formula | C25H24BrClF3N3O4S |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 633.03 |
| IUPAC Name | methyl 2-(4-bromo-N-[5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-(3-methylsulfanylpropyl)-3H-pyrazole-2-carbonyl]anilino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(C(=O)N1CC(C)(CCCSC)C(c2ccc(C(F)(F)F)c(Cl)c2)=N1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H24BrClF3N3O4S/c1-24(11-4-12-38-3)14-32(31-20(24)15-5-10-18(19(27)13-15)25(28,29)30)23(36)33(21(34)22(35)37-2)17-8-6-16(26)7-9-17/h5-10,13H,4,11-12,14H2,1-3H3 |
| InChIKey | OZENRNFZSLITBP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|