C20H31N3O9 — CID 19852951
[4-[3-[2-[acetyl(2-nitrooxyethoxy)amino]ethylamino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 19852951) has the molecular formula C20H31N3O9 and a molecular weight of 457.48 g/mol. Its IUPAC name is [4-[3-[2-[acetyl(2-nitrooxyethoxy)amino]ethylamino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[3-[2-[acetyl(2-nitrooxyethoxy)amino]ethylamino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 19852951 |
| Molecular Formula | C20H31N3O9 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [4-[3-[2-[acetyl(2-nitrooxyethoxy)amino]ethylamino]-2-hydroxypropoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCC(O)CNCCN(OCCO[N+](=O)[O-])C(C)=O)c(C)c1C |
| InChI | InChI=1S/C20H31N3O9/c1-13-10-19(14(2)15(3)20(13)32-17(5)25)29-12-18(26)11-21-6-7-22(16(4)24)30-8-9-31-23(27)28/h10,18,21,26H,6-9,11-12H2,1-5H3 |
| InChIKey | UWOSFCSCQYPAKT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|