C19H31N3O7 — CID 19852961
[4-[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]ethylamino]-3-methyl-4-oxobutyl] nitrate (PubChem CID 19852961) has the molecular formula C19H31N3O7 and a molecular weight of 413.47 g/mol. Its IUPAC name is [4-[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]ethylamino]-3-methyl-4-oxobutyl] nitrate.
| Compound Name | [4-[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]ethylamino]-3-methyl-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 19852961 |
| Molecular Formula | C19H31N3O7 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [4-[2-[[2-hydroxy-3-(4-hydroxy-2,3,5-trimethylphenoxy)propyl]amino]ethylamino]-3-methyl-4-oxobutyl] nitrate |
| SMILES | Cc1cc(OCC(O)CNCCNC(=O)C(C)CCO[N+](=O)[O-])c(C)c(C)c1O |
| InChI | InChI=1S/C19H31N3O7/c1-12(5-8-29-22(26)27)19(25)21-7-6-20-10-16(23)11-28-17-9-13(2)18(24)15(4)14(17)3/h9,12,16,20,23-24H,5-8,10-11H2,1-4H3,(H,21,25) |
| InChIKey | GKVYBOODKYCBKQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|