About 6-methyl-3a,4-dihydro-1-benzofuran
6-methyl-3a,4-dihydro-1-benzofuran (PubChem CID 19852976) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-methyl-3a,4-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 6-methyl-3a,4-dihydro-1-benzofuran |
| PubChem CID | 19852976 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 6-methyl-3a,4-dihydro-1-benzofuran |
| SMILES | CC1=CCC2C=COC2=C1 |
| InChI | InChI=1S/C9H10O/c1-7-2-3-8-4-5-10-9(8)6-7/h2,4-6,8H,3H2,1H3 |
| InChIKey | XPYQFBCFACGRDS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-3a,4-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3a,4-dihydro-1-benzofuran?
The IUPAC name of 6-methyl-3a,4-dihydro-1-benzofuran (CID 19852976) is 6-methyl-3a,4-dihydro-1-benzofuran.
What is the SMILES notation for 6-methyl-3a,4-dihydro-1-benzofuran?
The canonical SMILES for 6-methyl-3a,4-dihydro-1-benzofuran is CC1=CCC2C=COC2=C1.
What is the InChIKey of 6-methyl-3a,4-dihydro-1-benzofuran?
The InChIKey is XPYQFBCFACGRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7-2-3-8-4-5-10-9(8)6-7/h2,4-6,8H,3H2,1H3.
What are the key properties of 6-methyl-3a,4-dihydro-1-benzofuran?
6-methyl-3a,4-dihydro-1-benzofuran has a molecular weight of 134.18 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3a,4-dihydro-1-benzofuran is sourced from PubChem (CID 19852976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).