About thiophene;1-thiophen-2-ylpyrrole
thiophene;1-thiophen-2-ylpyrrole (PubChem CID 19853494) has the molecular formula C12H11NS2
and a molecular weight of 233.36 g/mol. Its IUPAC name is thiophene;1-thiophen-2-ylpyrrole.
Molecular Properties
| Compound Name | thiophene;1-thiophen-2-ylpyrrole |
| PubChem CID | 19853494 |
| Molecular Formula | C12H11NS2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | thiophene;1-thiophen-2-ylpyrrole |
| SMILES | c1ccsc1.c1csc(-n2cccc2)c1 |
| InChI | InChI=1S/C8H7NS.C4H4S/c1-2-6-9(5-1)8-4-3-7-10-8;1-2-4-5-3-1/h1-7H;1-4H |
| InChIKey | JXJBZVLLZDPHJA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophene;1-thiophen-2-ylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene;1-thiophen-2-ylpyrrole?
The IUPAC name of thiophene;1-thiophen-2-ylpyrrole (CID 19853494) is thiophene;1-thiophen-2-ylpyrrole.
What is the SMILES notation for thiophene;1-thiophen-2-ylpyrrole?
The canonical SMILES for thiophene;1-thiophen-2-ylpyrrole is c1ccsc1.c1csc(-n2cccc2)c1.
What is the InChIKey of thiophene;1-thiophen-2-ylpyrrole?
The InChIKey is JXJBZVLLZDPHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C4H4S/c1-2-6-9(5-1)8-4-3-7-10-8;1-2-4-5-3-1/h1-7H;1-4H.
What are the key properties of thiophene;1-thiophen-2-ylpyrrole?
thiophene;1-thiophen-2-ylpyrrole has a molecular weight of 233.36 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene;1-thiophen-2-ylpyrrole is sourced from PubChem (CID 19853494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).