About 1-chloroethanediazonium
1-chloroethanediazonium (PubChem CID 19853659) has the molecular formula C2H4ClN2+
and a molecular weight of 91.52 g/mol. Its IUPAC name is 1-chloroethanediazonium.
Molecular Properties
| Compound Name | 1-chloroethanediazonium |
| PubChem CID | 19853659 |
| Molecular Formula | C2H4ClN2+ |
| Molecular Weight | 91.52 g/mol |
| Exact Mass | 91.01 |
| IUPAC Name | 1-chloroethanediazonium |
| SMILES | CC(Cl)[N+]#N |
| InChI | InChI=1S/C2H4ClN2/c1-2(3)5-4/h2H,1H3/q+1 |
| InChIKey | NBOYGVZHJQNJHF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethanediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethanediazonium?
The IUPAC name of 1-chloroethanediazonium (CID 19853659) is 1-chloroethanediazonium.
What is the SMILES notation for 1-chloroethanediazonium?
The canonical SMILES for 1-chloroethanediazonium is CC(Cl)[N+]#N.
What is the InChIKey of 1-chloroethanediazonium?
The InChIKey is NBOYGVZHJQNJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClN2/c1-2(3)5-4/h2H,1H3/q+1.
What are the key properties of 1-chloroethanediazonium?
1-chloroethanediazonium has a molecular weight of 91.52 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethanediazonium is sourced from PubChem (CID 19853659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).