C19H20N2O4 — CID 19853865
N-(2,3-dihydroxypropyl)-3-methoxy-1-phenylindole-2-carboxamide (PubChem CID 19853865) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3-methoxy-1-phenylindole-2-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-3-methoxy-1-phenylindole-2-carboxamide |
|---|---|
| PubChem CID | 19853865 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3-methoxy-1-phenylindole-2-carboxamide |
| SMILES | COc1c(C(=O)NCC(O)CO)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H20N2O4/c1-25-18-15-9-5-6-10-16(15)21(13-7-3-2-4-8-13)17(18)19(24)20-11-14(23)12-22/h2-10,14,22-23H,11-12H2,1H3,(H,20,24) |
| InChIKey | CAOXMPJAYNYUSR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |