About 2-cycloheptylazepane
2-cycloheptylazepane (PubChem CID 19854924) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-cycloheptylazepane.
Molecular Properties
| Compound Name | 2-cycloheptylazepane |
| PubChem CID | 19854924 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-cycloheptylazepane |
| SMILES | C1CCCC(C2CCCCCN2)CC1 |
| InChI | InChI=1S/C13H25N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h12-14H,1-11H2 |
| InChIKey | HREMGZQEPGHZNC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cycloheptylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptylazepane?
The IUPAC name of 2-cycloheptylazepane (CID 19854924) is 2-cycloheptylazepane.
What is the SMILES notation for 2-cycloheptylazepane?
The canonical SMILES for 2-cycloheptylazepane is C1CCCC(C2CCCCCN2)CC1.
What is the InChIKey of 2-cycloheptylazepane?
The InChIKey is HREMGZQEPGHZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h12-14H,1-11H2.
What are the key properties of 2-cycloheptylazepane?
2-cycloheptylazepane has a molecular weight of 195.35 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptylazepane is sourced from PubChem (CID 19854924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).