C33H52N2O6 — CID 19855270
2-O-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate (PubChem CID 19855270) has the molecular formula C33H52N2O6 and a molecular weight of 572.79 g/mol. Its IUPAC name is 2-O-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19855270 |
| Molecular Formula | C33H52N2O6 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | 2-O-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) benzene-1,2-dicarboxylate |
| SMILES | CON1C(C)(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C33H52N2O6/c1-30(2)19-24(20-31(3,4)34(30)38-9)39-28(36)26-17-13-14-18-27(26)29(37)40-25-21-32(5,6)35(33(7,8)22-25)41-23-15-11-10-12-16-23/h13-14,17-18,23-25H,10-12,15-16,19-22H2,1-9H3 |
| InChIKey | SRHRYDMEBRHFNV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |