C30H42FNO4 — CID 19856500
methyl 2-[1-[3-[1-[4-(4-fluorophenyl)butoxy]pentyl]-5-methoxyphenyl]piperidin-2-yl]acetate (PubChem CID 19856500) has the molecular formula C30H42FNO4 and a molecular weight of 499.67 g/mol. Its IUPAC name is methyl 2-[1-[3-[1-[4-(4-fluorophenyl)butoxy]pentyl]-5-methoxyphenyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[3-[1-[4-(4-fluorophenyl)butoxy]pentyl]-5-methoxyphenyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 19856500 |
| Molecular Formula | C30H42FNO4 |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | methyl 2-[1-[3-[1-[4-(4-fluorophenyl)butoxy]pentyl]-5-methoxyphenyl]piperidin-2-yl]acetate |
| SMILES | CCCCC(OCCCCc1ccc(F)cc1)c1cc(OC)cc(N2CCCCC2CC(=O)OC)c1 |
| InChI | InChI=1S/C30H42FNO4/c1-4-5-12-29(36-18-9-7-10-23-13-15-25(31)16-14-23)24-19-27(21-28(20-24)34-2)32-17-8-6-11-26(32)22-30(33)35-3/h13-16,19-21,26,29H,4-12,17-18,22H2,1-3H3 |
| InChIKey | OLWXNVOKLPJQTK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|