C9H2BrF15 — CID 19856909
1-bromo-1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,1,2,3-pentafluoropropan-2-yl)cyclohexane (PubChem CID 19856909) has the molecular formula C9H2BrF15 and a molecular weight of 474.99 g/mol. Its IUPAC name is 1-bromo-1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,1,2,3-pentafluoropropan-2-yl)cyclohexane.
| Compound Name | 1-bromo-1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,1,2,3-pentafluoropropan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 19856909 |
| Molecular Formula | C9H2BrF15 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | 1-bromo-1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,1,2,3-pentafluoropropan-2-yl)cyclohexane |
| SMILES | FCC(F)(C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(Br)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H2BrF15/c10-4(14)7(19,20)5(15,16)3(13,6(17,18)8(4,21)22)2(12,1-11)9(23,24)25/h1H2 |
| InChIKey | DUUBFTRHGRKOGY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|