About 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid
3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid (PubChem CID 19856965) has the molecular formula C17H14O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid.
Molecular Properties
| Compound Name | 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid |
| PubChem CID | 19856965 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid |
| SMILES | O=C(O)c1cccc(C2=CC=CC2)c1OC1=CC=CC1 |
| InChI | InChI=1S/C17H14O3/c18-17(19)15-11-5-10-14(12-6-1-2-7-12)16(15)20-13-8-3-4-9-13/h1-6,8,10-11H,7,9H2,(H,18,19) |
| InChIKey | TYKIQBSWZHMTBM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid?
The IUPAC name of 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid (CID 19856965) is 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid.
What is the SMILES notation for 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid?
The canonical SMILES for 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid is O=C(O)c1cccc(C2=CC=CC2)c1OC1=CC=CC1.
What is the InChIKey of 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid?
The InChIKey is TYKIQBSWZHMTBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3/c18-17(19)15-11-5-10-14(12-6-1-2-7-12)16(15)20-13-8-3-4-9-13/h1-6,8,10-11H,7,9H2,(H,18,19).
What are the key properties of 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid?
3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid has a molecular weight of 266.30 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-1,3-dien-1-yl-2-cyclopenta-1,3-dien-1-yloxybenzoic acid is sourced from PubChem (CID 19856965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).