About 1-phenylpropan-2-yl butanoate
1-phenylpropan-2-yl butanoate (PubChem CID 19857768) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-phenylpropan-2-yl butanoate.
Molecular Properties
| Compound Name | 1-phenylpropan-2-yl butanoate |
| PubChem CID | 19857768 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-phenylpropan-2-yl butanoate |
| SMILES | CCCC(=O)OC(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-3-7-13(14)15-11(2)10-12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3 |
| InChIKey | ANJRGSHRMWLHFZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropan-2-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-2-yl butanoate?
The IUPAC name of 1-phenylpropan-2-yl butanoate (CID 19857768) is 1-phenylpropan-2-yl butanoate.
What is the SMILES notation for 1-phenylpropan-2-yl butanoate?
The canonical SMILES for 1-phenylpropan-2-yl butanoate is CCCC(=O)OC(C)Cc1ccccc1.
What is the InChIKey of 1-phenylpropan-2-yl butanoate?
The InChIKey is ANJRGSHRMWLHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-7-13(14)15-11(2)10-12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3.
What are the key properties of 1-phenylpropan-2-yl butanoate?
1-phenylpropan-2-yl butanoate has a molecular weight of 206.29 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-2-yl butanoate is sourced from PubChem (CID 19857768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).