About tert-butyl 3-butanoyloxybutanoate
tert-butyl 3-butanoyloxybutanoate (PubChem CID 19857773) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is tert-butyl 3-butanoyloxybutanoate.
Molecular Properties
| Compound Name | tert-butyl 3-butanoyloxybutanoate |
| PubChem CID | 19857773 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | tert-butyl 3-butanoyloxybutanoate |
| SMILES | CCCC(=O)OC(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O4/c1-6-7-10(13)15-9(2)8-11(14)16-12(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | XXTWJOTXWFVSDK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-butanoyloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-butanoyloxybutanoate?
The IUPAC name of tert-butyl 3-butanoyloxybutanoate (CID 19857773) is tert-butyl 3-butanoyloxybutanoate.
What is the SMILES notation for tert-butyl 3-butanoyloxybutanoate?
The canonical SMILES for tert-butyl 3-butanoyloxybutanoate is CCCC(=O)OC(C)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-butanoyloxybutanoate?
The InChIKey is XXTWJOTXWFVSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-6-7-10(13)15-9(2)8-11(14)16-12(3,4)5/h9H,6-8H2,1-5H3.
What are the key properties of tert-butyl 3-butanoyloxybutanoate?
tert-butyl 3-butanoyloxybutanoate has a molecular weight of 230.30 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-butanoyloxybutanoate is sourced from PubChem (CID 19857773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).