C16H13ClN4O5S2 — CID 19858110
methyl 1-[(4-chloro-3-sulfamoylbenzoyl)amino]-2-sulfanylidene-3H-benzimidazole-5-carboxylate (PubChem CID 19858110) has the molecular formula C16H13ClN4O5S2 and a molecular weight of 440.89 g/mol. Its IUPAC name is methyl 1-[(4-chloro-3-sulfamoylbenzoyl)amino]-2-sulfanylidene-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[(4-chloro-3-sulfamoylbenzoyl)amino]-2-sulfanylidene-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 19858110 |
| Molecular Formula | C16H13ClN4O5S2 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | methyl 1-[(4-chloro-3-sulfamoylbenzoyl)amino]-2-sulfanylidene-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c(=S)n2NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H13ClN4O5S2/c1-26-15(23)9-3-5-12-11(6-9)19-16(27)21(12)20-14(22)8-2-4-10(17)13(7-8)28(18,24)25/h2-7H,1H3,(H,19,27)(H,20,22)(H2,18,24,25) |
| InChIKey | RBSRUZPWBKEUOR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|