About 4,4-bis(chloromethyl)oxane
4,4-bis(chloromethyl)oxane (PubChem CID 19858283) has the molecular formula C7H12Cl2O
and a molecular weight of 183.08 g/mol. Its IUPAC name is 4,4-bis(chloromethyl)oxane.
Molecular Properties
| Compound Name | 4,4-bis(chloromethyl)oxane |
| PubChem CID | 19858283 |
| Molecular Formula | C7H12Cl2O |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 4,4-bis(chloromethyl)oxane |
| SMILES | ClCC1(CCl)CCOCC1 |
| InChI | InChI=1S/C7H12Cl2O/c8-5-7(6-9)1-3-10-4-2-7/h1-6H2 |
| InChIKey | UCMPIDSRISWZLR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(chloromethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(chloromethyl)oxane?
The IUPAC name of 4,4-bis(chloromethyl)oxane (CID 19858283) is 4,4-bis(chloromethyl)oxane.
What is the SMILES notation for 4,4-bis(chloromethyl)oxane?
The canonical SMILES for 4,4-bis(chloromethyl)oxane is ClCC1(CCl)CCOCC1.
What is the InChIKey of 4,4-bis(chloromethyl)oxane?
The InChIKey is UCMPIDSRISWZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2O/c8-5-7(6-9)1-3-10-4-2-7/h1-6H2.
What are the key properties of 4,4-bis(chloromethyl)oxane?
4,4-bis(chloromethyl)oxane has a molecular weight of 183.08 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(chloromethyl)oxane is sourced from PubChem (CID 19858283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).