C14H8ClNO5 — CID 19858486
1-amino-2-chloro-3,4,5-trihydroxyanthracene-9,10-dione (PubChem CID 19858486) has the molecular formula C14H8ClNO5 and a molecular weight of 305.67 g/mol. Its IUPAC name is 1-amino-2-chloro-3,4,5-trihydroxyanthracene-9,10-dione.
| Compound Name | 1-amino-2-chloro-3,4,5-trihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 19858486 |
| Molecular Formula | C14H8ClNO5 |
| Molecular Weight | 305.67 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 1-amino-2-chloro-3,4,5-trihydroxyanthracene-9,10-dione |
| SMILES | Nc1c(Cl)c(O)c(O)c2c1C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C14H8ClNO5/c15-9-10(16)7-8(13(20)14(9)21)12(19)6-4(11(7)18)2-1-3-5(6)17/h1-3,17,20-21H,16H2 |
| InChIKey | FKBCOTWKRLBOBM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|