About 2-cyanoguanidine;guanidine
2-cyanoguanidine;guanidine (PubChem CID 19858542) has the molecular formula C3H9N7
and a molecular weight of 143.15 g/mol. Its IUPAC name is 2-cyanoguanidine;guanidine.
Molecular Properties
| Compound Name | 2-cyanoguanidine;guanidine |
| PubChem CID | 19858542 |
| Molecular Formula | C3H9N7 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-cyanoguanidine;guanidine |
| SMILES | N#CN=C(N)N.[H]N=C(N)N |
| InChI | InChI=1S/C2H4N4.CH5N3/c3-1-6-2(4)5;2-1(3)4/h(H4,4,5,6);(H5,2,3,4) |
| InChIKey | FIYYUWIKERTXDF-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 164.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoguanidine;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoguanidine;guanidine?
The IUPAC name of 2-cyanoguanidine;guanidine (CID 19858542) is 2-cyanoguanidine;guanidine.
What is the SMILES notation for 2-cyanoguanidine;guanidine?
The canonical SMILES for 2-cyanoguanidine;guanidine is N#CN=C(N)N.[H]N=C(N)N.
What is the InChIKey of 2-cyanoguanidine;guanidine?
The InChIKey is FIYYUWIKERTXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.CH5N3/c3-1-6-2(4)5;2-1(3)4/h(H4,4,5,6);(H5,2,3,4).
What are the key properties of 2-cyanoguanidine;guanidine?
2-cyanoguanidine;guanidine has a molecular weight of 143.15 g/mol, XLogP of -2.42, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoguanidine;guanidine is sourced from PubChem (CID 19858542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).