C37H26F6N2O10 — CID 19858602
4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;benzene-1,2,4,5-tetracarboxylic acid (PubChem CID 19858602) has the molecular formula C37H26F6N2O10 and a molecular weight of 772.61 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;benzene-1,2,4,5-tetracarboxylic acid.
| Compound Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;benzene-1,2,4,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 19858602 |
| Molecular Formula | C37H26F6N2O10 |
| Molecular Weight | 772.61 g/mol |
| Exact Mass | 772.15 |
| IUPAC Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;benzene-1,2,4,5-tetracarboxylic acid |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1.O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C27H20F6N2O2.C10H6O8/c28-26(29,30)25(27(31,32)33,17-1-9-21(10-2-17)36-23-13-5-19(34)6-14-23)18-3-11-22(12-4-18)37-24-15-7-20(35)8-16-24;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-16H,34-35H2;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | OOLLMCYKYVUMOO-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 219.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|