About [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate
[4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate (PubChem CID 19858743) has the molecular formula C34H44FNO2
and a molecular weight of 517.73 g/mol. Its IUPAC name is [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate.
Molecular Properties
| Compound Name | [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate |
| PubChem CID | 19858743 |
| Molecular Formula | C34H44FNO2 |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)cc3F)cc2)nc1 |
| InChI | InChI=1S/C34H44FNO2/c1-3-5-7-9-11-13-15-27-17-23-31(32(35)25-27)34(37)38-30-21-19-29(20-22-30)33-24-18-28(26-36-33)16-14-12-10-8-6-4-2/h17-26H,3-16H2,1-2H3 |
| InChIKey | XEIAYKDVXHTLQM-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate?
The IUPAC name of [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate (CID 19858743) is [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate.
What is the SMILES notation for [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate?
The canonical SMILES for [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate is CCCCCCCCc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)cc3F)cc2)nc1.
What is the InChIKey of [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate?
The InChIKey is XEIAYKDVXHTLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H44FNO2/c1-3-5-7-9-11-13-15-27-17-23-31(32(35)25-27)34(37)38-30-21-19-29(20-22-30)33-24-18-28(26-36-33)16-14-12-10-8-6-4-2/h17-26H,3-16H2,1-2H3.
What are the key properties of [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate?
[4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate has a molecular weight of 517.73 g/mol, XLogP of 9.91, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-octyl-2-pyridinyl)phenyl] 2-fluoro-4-octylbenzoate is sourced from PubChem (CID 19858743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).