C18H30N2O4 — CID 19860717
2,4,5,6-tetrakis(oxiran-2-ylmethyl)cyclohexane-1,3-diamine (PubChem CID 19860717) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2,4,5,6-tetrakis(oxiran-2-ylmethyl)cyclohexane-1,3-diamine.
| Compound Name | 2,4,5,6-tetrakis(oxiran-2-ylmethyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 19860717 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2,4,5,6-tetrakis(oxiran-2-ylmethyl)cyclohexane-1,3-diamine |
| SMILES | NC1C(CC2CO2)C(N)C(CC2CO2)C(CC2CO2)C1CC1CO1 |
| InChI | InChI=1S/C18H30N2O4/c19-17-14(2-10-6-22-10)13(1-9-5-21-9)15(3-11-7-23-11)18(20)16(17)4-12-8-24-12/h9-18H,1-8,19-20H2 |
| InChIKey | SMPDDUPNAMCENK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|