About (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate
(2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate (PubChem CID 19860911) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate.
Molecular Properties
| Compound Name | (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate |
| PubChem CID | 19860911 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OC1=CC(=O)OC(C)C1 |
| InChI | InChI=1S/C18H30O4/c1-3-4-5-6-7-8-9-10-11-12-17(19)22-16-13-15(2)21-18(20)14-16/h14-15H,3-13H2,1-2H3 |
| InChIKey | IKMYNPVWGYHKQN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate?
The IUPAC name of (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate (CID 19860911) is (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate.
What is the SMILES notation for (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate?
The canonical SMILES for (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate is CCCCCCCCCCCC(=O)OC1=CC(=O)OC(C)C1.
What is the InChIKey of (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate?
The InChIKey is IKMYNPVWGYHKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-3-4-5-6-7-8-9-10-11-12-17(19)22-16-13-15(2)21-18(20)14-16/h14-15H,3-13H2,1-2H3.
What are the key properties of (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate?
(2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate has a molecular weight of 310.43 g/mol, XLogP of 4.67, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-6-oxo-2,3-dihydropyran-4-yl) dodecanoate is sourced from PubChem (CID 19860911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).