C25H32Cl2N2O — CID 19861535
4-[(1E,3E)-5-butoxy-5-[2-chloro-4-(dimethylamino)phenyl]penta-1,3-dienyl]-3-chloro-N,N-dimethylaniline (PubChem CID 19861535) has the molecular formula C25H32Cl2N2O and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-[(1E,3E)-5-butoxy-5-[2-chloro-4-(dimethylamino)phenyl]penta-1,3-dienyl]-3-chloro-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-5-butoxy-5-[2-chloro-4-(dimethylamino)phenyl]penta-1,3-dienyl]-3-chloro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19861535 |
| Molecular Formula | C25H32Cl2N2O |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[(1E,3E)-5-butoxy-5-[2-chloro-4-(dimethylamino)phenyl]penta-1,3-dienyl]-3-chloro-N,N-dimethylaniline |
| SMILES | CCCCOC(/C=C/C=C/c1ccc(N(C)C)cc1Cl)c1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C25H32Cl2N2O/c1-6-7-16-30-25(22-15-14-21(29(4)5)18-24(22)27)11-9-8-10-19-12-13-20(28(2)3)17-23(19)26/h8-15,17-18,25H,6-7,16H2,1-5H3/b10-8+,11-9+ |
| InChIKey | VHILDEWBPZNYSW-GFULKKFKSA-N |
| XLogP | 7.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|