About 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide
4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide (PubChem CID 19861564) has the molecular formula C14H10Cl3F3N4O3
and a molecular weight of 445.61 g/mol. Its IUPAC name is 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide.
Molecular Properties
| Compound Name | 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide |
| PubChem CID | 19861564 |
| Molecular Formula | C14H10Cl3F3N4O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide |
| SMILES | O=C(CCCCl)Nc1c([N+](=O)[O-])cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H10Cl3F3N4O3/c15-3-1-2-11(25)22-13-10(24(26)27)6-21-23(13)12-8(16)4-7(5-9(12)17)14(18,19)20/h4-6H,1-3H2,(H,22,25) |
| InChIKey | BWMPFUZEXJZLRE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide?
The IUPAC name of 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide (CID 19861564) is 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide.
What is the SMILES notation for 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide?
The canonical SMILES for 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide is O=C(CCCCl)Nc1c([N+](=O)[O-])cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide?
The InChIKey is BWMPFUZEXJZLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl3F3N4O3/c15-3-1-2-11(25)22-13-10(24(26)27)6-21-23(13)12-8(16)4-7(5-9(12)17)14(18,19)20/h4-6H,1-3H2,(H,22,25).
What are the key properties of 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide?
4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide has a molecular weight of 445.61 g/mol, XLogP of 5.06, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitropyrazol-5-yl]butanamide is sourced from PubChem (CID 19861564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).