C12H12O6 — CID 19861625
1-(2-methylprop-2-enoyloxy)cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 19861625) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyloxy)cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 1-(2-methylprop-2-enoyloxy)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 19861625 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-(2-methylprop-2-enoyloxy)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OC1(C(=O)O)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C12H12O6/c1-7(2)10(15)18-12(11(16)17)6-4-3-5-8(12)9(13)14/h3-6,8H,1H2,2H3,(H,13,14)(H,16,17) |
| InChIKey | XLTXRXZPEYODID-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|