About 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine
8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 19861727) has the molecular formula C8H7ClFNS
and a molecular weight of 203.67 g/mol. Its IUPAC name is 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine |
| PubChem CID | 19861727 |
| Molecular Formula | C8H7ClFNS |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | Fc1ccc2c(c1Cl)SCCN2 |
| InChI | InChI=1S/C8H7ClFNS/c9-7-5(10)1-2-6-8(7)12-4-3-11-6/h1-2,11H,3-4H2 |
| InChIKey | XCRZLKBHYMIZTK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine?
The IUPAC name of 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine (CID 19861727) is 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine.
What is the SMILES notation for 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine?
The canonical SMILES for 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine is Fc1ccc2c(c1Cl)SCCN2.
What is the InChIKey of 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine?
The InChIKey is XCRZLKBHYMIZTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClFNS/c9-7-5(10)1-2-6-8(7)12-4-3-11-6/h1-2,11H,3-4H2.
What are the key properties of 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine?
8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine has a molecular weight of 203.67 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-7-fluoro-3,4-dihydro-2H-1,4-benzothiazine is sourced from PubChem (CID 19861727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).