C19H24N8O3 — CID 19861844
1-morpholin-4-yl-3-[4-(2,4,7-triaminopteridin-6-yl)phenoxy]propan-2-ol (PubChem CID 19861844) has the molecular formula C19H24N8O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-[4-(2,4,7-triaminopteridin-6-yl)phenoxy]propan-2-ol.
| Compound Name | 1-morpholin-4-yl-3-[4-(2,4,7-triaminopteridin-6-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 19861844 |
| Molecular Formula | C19H24N8O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-morpholin-4-yl-3-[4-(2,4,7-triaminopteridin-6-yl)phenoxy]propan-2-ol |
| SMILES | Nc1nc(N)c2nc(-c3ccc(OCC(O)CN4CCOCC4)cc3)c(N)nc2n1 |
| InChI | InChI=1S/C19H24N8O3/c20-16-14(23-15-17(21)25-19(22)26-18(15)24-16)11-1-3-13(4-2-11)30-10-12(28)9-27-5-7-29-8-6-27/h1-4,12,28H,5-10H2,(H6,20,21,22,24,25,26) |
| InChIKey | VJCSYIZREJSUFT-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 171.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |