About 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol
2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol (PubChem CID 19861962) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol.
Molecular Properties
| Compound Name | 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol |
| PubChem CID | 19861962 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol |
| SMILES | CSCCC1OCC(O)O1 |
| InChI | InChI=1S/C6H12O3S/c1-10-3-2-6-8-4-5(7)9-6/h5-7H,2-4H2,1H3 |
| InChIKey | JKMYTXLEDSWISS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol?
The IUPAC name of 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol (CID 19861962) is 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol.
What is the SMILES notation for 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol?
The canonical SMILES for 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol is CSCCC1OCC(O)O1.
What is the InChIKey of 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol?
The InChIKey is JKMYTXLEDSWISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c1-10-3-2-6-8-4-5(7)9-6/h5-7H,2-4H2,1H3.
What are the key properties of 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol?
2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol has a molecular weight of 164.23 g/mol, XLogP of 0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfanylethyl)-1,3-dioxolan-4-ol is sourced from PubChem (CID 19861962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).