C7H13NO — CID 19862111
2,4,6-trimethyl-2,3-dihydro-1,4-oxazine (PubChem CID 19862111) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 2,4,6-trimethyl-2,3-dihydro-1,4-oxazine.
| Compound Name | 2,4,6-trimethyl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 19862111 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2,4,6-trimethyl-2,3-dihydro-1,4-oxazine |
| SMILES | CC1=CN(C)CC(C)O1 |
| InChI | InChI=1S/C7H13NO/c1-6-4-8(3)5-7(2)9-6/h4,7H,5H2,1-3H3 |
| InChIKey | GMKJECGIARQABX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |