About ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate
ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate (PubChem CID 19862585) has the molecular formula C13H18N2O5
and a molecular weight of 282.30 g/mol. Its IUPAC name is ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate |
| PubChem CID | 19862585 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)Oc1c(C)n(C)ccc1=O |
| InChI | InChI=1S/C13H18N2O5/c1-4-19-11(17)5-7-14-13(18)20-12-9(2)15(3)8-6-10(12)16/h6,8H,4-5,7H2,1-3H3,(H,14,18) |
| InChIKey | WMCCXZWFDVSIOK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate?
The IUPAC name of ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate (CID 19862585) is ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate.
What is the SMILES notation for ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate?
The canonical SMILES for ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate is CCOC(=O)CCNC(=O)Oc1c(C)n(C)ccc1=O.
What is the InChIKey of ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate?
The InChIKey is WMCCXZWFDVSIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5/c1-4-19-11(17)5-7-14-13(18)20-12-9(2)15(3)8-6-10(12)16/h6,8H,4-5,7H2,1-3H3,(H,14,18).
What are the key properties of ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate?
ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate has a molecular weight of 282.30 g/mol, XLogP of 0.74, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(1,2-dimethyl-4-oxo-3-pyridinyl)oxycarbonylamino]propanoate is sourced from PubChem (CID 19862585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).