About [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate
[1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate (PubChem CID 19862608) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate |
| PubChem CID | 19862608 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate |
| SMILES | CCOCCn1ccc(=O)c(OC(=O)N(CC)CC)c1C |
| InChI | InChI=1S/C15H24N2O4/c1-5-16(6-2)15(19)21-14-12(4)17(9-8-13(14)18)10-11-20-7-3/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | QAKMJLFWMZNHII-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate?
The IUPAC name of [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate (CID 19862608) is [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate.
What is the SMILES notation for [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate?
The canonical SMILES for [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate is CCOCCn1ccc(=O)c(OC(=O)N(CC)CC)c1C.
What is the InChIKey of [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate?
The InChIKey is QAKMJLFWMZNHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-5-16(6-2)15(19)21-14-12(4)17(9-8-13(14)18)10-11-20-7-3/h8-9H,5-7,10-11H2,1-4H3.
What are the key properties of [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate?
[1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate has a molecular weight of 296.37 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-ethoxyethyl)-2-methyl-4-oxo-3-pyridinyl] N,N-diethylcarbamate is sourced from PubChem (CID 19862608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).