About 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole
6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole (PubChem CID 19862991) has the molecular formula C17H14N2O2
and a molecular weight of 278.31 g/mol. Its IUPAC name is 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole.
Molecular Properties
| Compound Name | 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole |
| PubChem CID | 19862991 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole |
| SMILES | COc1cccc2c1CCc1nc(-c3ccncc3)oc1-2 |
| InChI | InChI=1S/C17H14N2O2/c1-20-15-4-2-3-13-12(15)5-6-14-16(13)21-17(19-14)11-7-9-18-10-8-11/h2-4,7-10H,5-6H2,1H3 |
| InChIKey | HHVNKRASYNCBTH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole?
The IUPAC name of 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole (CID 19862991) is 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole.
What is the SMILES notation for 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole?
The canonical SMILES for 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole is COc1cccc2c1CCc1nc(-c3ccncc3)oc1-2.
What is the InChIKey of 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole?
The InChIKey is HHVNKRASYNCBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2/c1-20-15-4-2-3-13-12(15)5-6-14-16(13)21-17(19-14)11-7-9-18-10-8-11/h2-4,7-10H,5-6H2,1H3.
What are the key properties of 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole?
6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole has a molecular weight of 278.31 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-pyridin-4-yl-4,5-dihydrobenzo[g][1,3]benzoxazole is sourced from PubChem (CID 19862991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).